C12H16N4O2S — CID 64831018
3-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 64831018) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 64831018 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-[[5-(ethylamino)thiadiazol-4-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CCNc1snnc1CN1C(=O)C2C(C1=O)C2(C)C |
| InChI | InChI=1S/C12H16N4O2S/c1-4-13-9-6(14-15-19-9)5-16-10(17)7-8(11(16)18)12(7,2)3/h7-8,13H,4-5H2,1-3H3 |
| InChIKey | PTBUDKBGLNNYLW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|