About 2-[(2,6-dichlorophenyl)methoxy]pyridine
2-[(2,6-dichlorophenyl)methoxy]pyridine (PubChem CID 648335) has the molecular formula C12H9Cl2NO
and a molecular weight of 254.12 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methoxy]pyridine.
Molecular Properties
| Compound Name | 2-[(2,6-dichlorophenyl)methoxy]pyridine |
| PubChem CID | 648335 |
| Molecular Formula | C12H9Cl2NO |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methoxy]pyridine |
| SMILES | Clc1cccc(Cl)c1COc1ccccn1 |
| InChI | InChI=1S/C12H9Cl2NO/c13-10-4-3-5-11(14)9(10)8-16-12-6-1-2-7-15-12/h1-7H,8H2 |
| InChIKey | KQLSGIWMHRZFKP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2,6-dichlorophenyl)methoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichlorophenyl)methoxy]pyridine?
The IUPAC name of 2-[(2,6-dichlorophenyl)methoxy]pyridine (CID 648335) is 2-[(2,6-dichlorophenyl)methoxy]pyridine.
What is the SMILES notation for 2-[(2,6-dichlorophenyl)methoxy]pyridine?
The canonical SMILES for 2-[(2,6-dichlorophenyl)methoxy]pyridine is Clc1cccc(Cl)c1COc1ccccn1.
What is the InChIKey of 2-[(2,6-dichlorophenyl)methoxy]pyridine?
The InChIKey is KQLSGIWMHRZFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2NO/c13-10-4-3-5-11(14)9(10)8-16-12-6-1-2-7-15-12/h1-7H,8H2.
What are the key properties of 2-[(2,6-dichlorophenyl)methoxy]pyridine?
2-[(2,6-dichlorophenyl)methoxy]pyridine has a molecular weight of 254.12 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichlorophenyl)methoxy]pyridine is sourced from PubChem (CID 648335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).