About 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide
2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide (PubChem CID 6483360) has the molecular formula C19H15NO3S
and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide.
Molecular Properties
| Compound Name | 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide |
| PubChem CID | 6483360 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide |
| SMILES | NC(=O)C1=C(O)OC2=C(CSc3ccccc32)C1c1ccccc1 |
| InChI | InChI=1S/C19H15NO3S/c20-18(21)16-15(11-6-2-1-3-7-11)13-10-24-14-9-5-4-8-12(14)17(13)23-19(16)22/h1-9,15,22H,10H2,(H2,20,21) |
| InChIKey | LNNUBMBLLDTUOM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide?
The IUPAC name of 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide (CID 6483360) is 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide.
What is the SMILES notation for 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide?
The canonical SMILES for 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide is NC(=O)C1=C(O)OC2=C(CSc3ccccc32)C1c1ccccc1.
What is the InChIKey of 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide?
The InChIKey is LNNUBMBLLDTUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO3S/c20-18(21)16-15(11-6-2-1-3-7-11)13-10-24-14-9-5-4-8-12(14)17(13)23-19(16)22/h1-9,15,22H,10H2,(H2,20,21).
What are the key properties of 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide?
2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide has a molecular weight of 337.40 g/mol, XLogP of 3.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-phenyl-4,5-dihydrothiochromeno[4,3-b]pyran-3-carboxamide is sourced from PubChem (CID 6483360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).