About 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane
4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane (PubChem CID 64833664) has the molecular formula C11H20F2N2
and a molecular weight of 218.29 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane |
| PubChem CID | 64833664 |
| Molecular Formula | C11H20F2N2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane |
| SMILES | FC(F)CN1CCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C11H20F2N2/c12-10(13)8-15-7-6-14-11(9-15)4-2-1-3-5-11/h10,14H,1-9H2 |
| InChIKey | KUGYHGDMPLPNGP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane?
The IUPAC name of 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane (CID 64833664) is 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane.
What is the SMILES notation for 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane?
The canonical SMILES for 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane is FC(F)CN1CCNC2(CCCCC2)C1.
What is the InChIKey of 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane?
The InChIKey is KUGYHGDMPLPNGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2/c12-10(13)8-15-7-6-14-11(9-15)4-2-1-3-5-11/h10,14H,1-9H2.
What are the key properties of 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane?
4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane has a molecular weight of 218.29 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethyl)-1,4-diazaspiro[5.5]undecane is sourced from PubChem (CID 64833664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).