About 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid
2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid (PubChem CID 64835910) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid |
| PubChem CID | 64835910 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid |
| SMILES | CC1(C)C2C(=O)N(C(C(=O)O)C3CC3)C(=O)C21 |
| InChI | InChI=1S/C12H15NO4/c1-12(2)6-7(12)10(15)13(9(6)14)8(11(16)17)5-3-4-5/h5-8H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | YPTUMYDKIKBVLF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid?
The IUPAC name of 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid (CID 64835910) is 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid.
What is the SMILES notation for 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid?
The canonical SMILES for 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid is CC1(C)C2C(=O)N(C(C(=O)O)C3CC3)C(=O)C21.
What is the InChIKey of 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid?
The InChIKey is YPTUMYDKIKBVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-12(2)6-7(12)10(15)13(9(6)14)8(11(16)17)5-3-4-5/h5-8H,3-4H2,1-2H3,(H,16,17).
What are the key properties of 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid?
2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid has a molecular weight of 237.25 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)acetic acid is sourced from PubChem (CID 64835910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).