About 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide
2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide (PubChem CID 64836246) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide |
| PubChem CID | 64836246 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide |
| SMILES | CC(=O)C(NC(=O)CN1C(=O)C2CC2C1=O)C(C)C |
| InChI | InChI=1S/C13H18N2O4/c1-6(2)11(7(3)16)14-10(17)5-15-12(18)8-4-9(8)13(15)19/h6,8-9,11H,4-5H2,1-3H3,(H,14,17) |
| InChIKey | KMXCCGBXKAUZEI-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide?
The IUPAC name of 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide (CID 64836246) is 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide.
What is the SMILES notation for 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide?
The canonical SMILES for 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide is CC(=O)C(NC(=O)CN1C(=O)C2CC2C1=O)C(C)C.
What is the InChIKey of 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide?
The InChIKey is KMXCCGBXKAUZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-6(2)11(7(3)16)14-10(17)5-15-12(18)8-4-9(8)13(15)19/h6,8-9,11H,4-5H2,1-3H3,(H,14,17).
What are the key properties of 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide?
2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide has a molecular weight of 266.30 g/mol, XLogP of -0.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-N-(2-methyl-4-oxopentan-3-yl)acetamide is sourced from PubChem (CID 64836246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).