C25H26N2O6 — CID 6483644
methyl (Z)-6-(2,7-dimethyl-3-oxo-1,2-benzoxazol-5-yl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate (PubChem CID 6483644) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is methyl (Z)-6-(2,7-dimethyl-3-oxo-1,2-benzoxazol-5-yl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate.
| Compound Name | methyl (Z)-6-(2,7-dimethyl-3-oxo-1,2-benzoxazol-5-yl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate |
|---|---|
| PubChem CID | 6483644 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | methyl (Z)-6-(2,7-dimethyl-3-oxo-1,2-benzoxazol-5-yl)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)hex-5-enoate |
| SMILES | COC(=O)CCC/C=C(/c1cc(C)c2on(C)c(=O)c2c1)c1cc(C)c2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C25H26N2O6/c1-14-10-16(12-19-22(14)33-27(4)24(19)29)18(8-6-7-9-21(28)31-5)17-11-15(2)23-20(13-17)26(3)25(30)32-23/h8,10-13H,6-7,9H2,1-5H3/b18-8- |
| InChIKey | OOUKTVSPSJOIOG-LSCVHKIXSA-N |
| XLogP | 3.97 |
| TPSA | 96.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|