C27H17N3O3 — CID 6483660
7-methoxy-13-phenyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 6483660) has the molecular formula C27H17N3O3 and a molecular weight of 431.45 g/mol. Its IUPAC name is 7-methoxy-13-phenyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 7-methoxy-13-phenyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 6483660 |
| Molecular Formula | C27H17N3O3 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 7-methoxy-13-phenyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | COc1ccc2[nH]c3c4[nH]c5ccccc5c4c4c(c3c2c1)C(=O)N(c1ccccc1)C4=O |
| InChI | InChI=1S/C27H17N3O3/c1-33-15-11-12-19-17(13-15)21-23-22(26(31)30(27(23)32)14-7-3-2-4-8-14)20-16-9-5-6-10-18(16)28-24(20)25(21)29-19/h2-13,28-29H,1H3 |
| InChIKey | HZXLUXGBCWNBTC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|