About methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate
methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate (PubChem CID 64837033) has the molecular formula C15H24N2O4
and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate.
Molecular Properties
| Compound Name | methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate |
| PubChem CID | 64837033 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate |
| SMILES | COC(=O)C(C)(N)CCCCN1C(=O)C2C(C1=O)C2(C)C |
| InChI | InChI=1S/C15H24N2O4/c1-14(2)9-10(14)12(19)17(11(9)18)8-6-5-7-15(3,16)13(20)21-4/h9-10H,5-8,16H2,1-4H3 |
| InChIKey | KVULJKCEWAIZSZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate?
The IUPAC name of methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate (CID 64837033) is methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate.
What is the SMILES notation for methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate?
The canonical SMILES for methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate is COC(=O)C(C)(N)CCCCN1C(=O)C2C(C1=O)C2(C)C.
What is the InChIKey of methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate?
The InChIKey is KVULJKCEWAIZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O4/c1-14(2)9-10(14)12(19)17(11(9)18)8-6-5-7-15(3,16)13(20)21-4/h9-10H,5-8,16H2,1-4H3.
What are the key properties of methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate?
methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate has a molecular weight of 296.37 g/mol, XLogP of 0.69, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-6-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-methylhexanoate is sourced from PubChem (CID 64837033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).