C15H25N3O3 — CID 64837222
5-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-(ethylamino)-2-methylpentanamide (PubChem CID 64837222) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 5-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-(ethylamino)-2-methylpentanamide.
| Compound Name | 5-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-(ethylamino)-2-methylpentanamide |
|---|---|
| PubChem CID | 64837222 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 5-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-2-(ethylamino)-2-methylpentanamide |
| SMILES | CCNC(C)(CCCN1C(=O)C2C(C1=O)C2(C)C)C(N)=O |
| InChI | InChI=1S/C15H25N3O3/c1-5-17-15(4,13(16)21)7-6-8-18-11(19)9-10(12(18)20)14(9,2)3/h9-10,17H,5-8H2,1-4H3,(H2,16,21) |
| InChIKey | CQXMTVPXUUOHCZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|