C11H15BrO — CID 6483771
1-(3-bromopropoxy)-2,3-dimethylbenzene (PubChem CID 6483771) has the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. Its IUPAC name is 1-(3-bromopropoxy)-2,3-dimethylbenzene.
| Compound Name | 1-(3-bromopropoxy)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 6483771 |
| Molecular Formula | C11H15BrO |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-(3-bromopropoxy)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(OCCCBr)c1C |
| InChI | InChI=1S/C11H15BrO/c1-9-5-3-6-11(10(9)2)13-8-4-7-12/h3,5-6H,4,7-8H2,1-2H3 |
| InChIKey | WQJLOZXIOCMMJX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|