About 5-propan-2-yl-1,2-oxazole-3-carboxylic acid
5-propan-2-yl-1,2-oxazole-3-carboxylic acid (PubChem CID 6483812) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 5-propan-2-yl-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 6483812 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 5-propan-2-yl-1,2-oxazole-3-carboxylic acid |
| SMILES | CC(C)c1cc(C(=O)O)no1 |
| InChI | InChI=1S/C7H9NO3/c1-4(2)6-3-5(7(9)10)8-11-6/h3-4H,1-2H3,(H,9,10) |
| InChIKey | AYWGKTMGWXRLRO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propan-2-yl-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-propan-2-yl-1,2-oxazole-3-carboxylic acid (CID 6483812) is 5-propan-2-yl-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-propan-2-yl-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-propan-2-yl-1,2-oxazole-3-carboxylic acid is CC(C)c1cc(C(=O)O)no1.
What is the InChIKey of 5-propan-2-yl-1,2-oxazole-3-carboxylic acid?
The InChIKey is AYWGKTMGWXRLRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-4(2)6-3-5(7(9)10)8-11-6/h3-4H,1-2H3,(H,9,10).
What are the key properties of 5-propan-2-yl-1,2-oxazole-3-carboxylic acid?
5-propan-2-yl-1,2-oxazole-3-carboxylic acid has a molecular weight of 155.15 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 6483812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).