About 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine
2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine (PubChem CID 64838151) has the molecular formula C17H26Cl2N2
and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine |
| PubChem CID | 64838151 |
| Molecular Formula | C17H26Cl2N2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine |
| SMILES | CCC(C)C1CNC(C)(C)CN1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H26Cl2N2/c1-5-12(2)16-9-20-17(3,4)11-21(16)10-13-6-7-14(18)15(19)8-13/h6-8,12,16,20H,5,9-11H2,1-4H3 |
| InChIKey | XWFBADGUTYZKAU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine?
The IUPAC name of 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine (CID 64838151) is 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine.
What is the SMILES notation for 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine?
The canonical SMILES for 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine is CCC(C)C1CNC(C)(C)CN1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine?
The InChIKey is XWFBADGUTYZKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26Cl2N2/c1-5-12(2)16-9-20-17(3,4)11-21(16)10-13-6-7-14(18)15(19)8-13/h6-8,12,16,20H,5,9-11H2,1-4H3.
What are the key properties of 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine?
2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine has a molecular weight of 329.31 g/mol, XLogP of 4.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-1-[(3,4-dichlorophenyl)methyl]-5,5-dimethylpiperazine is sourced from PubChem (CID 64838151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).