About 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid
2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid (PubChem CID 6483880) has the molecular formula C7H6O4S
and a molecular weight of 186.19 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid.
Analyze 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid?
The IUPAC name of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid (CID 6483880) is 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid.
What is the SMILES notation for 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid?
The canonical SMILES for 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid is O=C(O)c1scc2c1OCCO2.
What is the InChIKey of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid?
The InChIKey is DCCRIIFBJZOPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4S/c8-7(9)6-5-4(3-12-6)10-1-2-11-5/h3H,1-2H2,(H,8,9).
What are the key properties of 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid?
2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid has a molecular weight of 186.19 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid is sourced from PubChem (CID 6483880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).