C15H27F3N2O — CID 64839211
8-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane (PubChem CID 64839211) has the molecular formula C15H27F3N2O and a molecular weight of 308.39 g/mol. Its IUPAC name is 8-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64839211 |
| Molecular Formula | C15H27F3N2O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 8-propyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane |
| SMILES | CCCC1CN(CCOCC(F)(F)F)C2(CCCC2)CN1 |
| InChI | InChI=1S/C15H27F3N2O/c1-2-5-13-10-20(8-9-21-12-15(16,17)18)14(11-19-13)6-3-4-7-14/h13,19H,2-12H2,1H3 |
| InChIKey | LORIRWPVUSEQKQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|