C15H30N2O — CID 64839542
2-tert-butyl-5,5-dimethyl-1-(oxolan-2-ylmethyl)piperazine (PubChem CID 64839542) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-tert-butyl-5,5-dimethyl-1-(oxolan-2-ylmethyl)piperazine.
| Compound Name | 2-tert-butyl-5,5-dimethyl-1-(oxolan-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 64839542 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2-tert-butyl-5,5-dimethyl-1-(oxolan-2-ylmethyl)piperazine |
| SMILES | CC1(C)CN(CC2CCCO2)C(C(C)(C)C)CN1 |
| InChI | InChI=1S/C15H30N2O/c1-14(2,3)13-9-16-15(4,5)11-17(13)10-12-7-6-8-18-12/h12-13,16H,6-11H2,1-5H3 |
| InChIKey | HOACDJQYPORILB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |