About 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide
1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide (PubChem CID 6483961) has the molecular formula C21H22N4O
and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide |
| PubChem CID | 6483961 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cn(CCC#N)nc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H22N4O/c1-3-24(4-2)21(26)19-15-25(13-7-12-22)23-20(19)18-11-10-16-8-5-6-9-17(16)14-18/h5-6,8-11,14-15H,3-4,7,13H2,1-2H3 |
| InChIKey | JPELQPOFLNSWDZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide?
The IUPAC name of 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide (CID 6483961) is 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide.
What is the SMILES notation for 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide?
The canonical SMILES for 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide is CCN(CC)C(=O)c1cn(CCC#N)nc1-c1ccc2ccccc2c1.
What is the InChIKey of 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide?
The InChIKey is JPELQPOFLNSWDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O/c1-3-24(4-2)21(26)19-15-25(13-7-12-22)23-20(19)18-11-10-16-8-5-6-9-17(16)14-18/h5-6,8-11,14-15H,3-4,7,13H2,1-2H3.
What are the key properties of 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide?
1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide has a molecular weight of 346.43 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyanoethyl)-N,N-diethyl-3-naphthalen-2-ylpyrazole-4-carboxamide is sourced from PubChem (CID 6483961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).