C17H21BrN2S — CID 64839742
1-[(3-bromothiophen-2-yl)methyl]-5,5-dimethyl-2-phenylpiperazine (PubChem CID 64839742) has the molecular formula C17H21BrN2S and a molecular weight of 365.34 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-5,5-dimethyl-2-phenylpiperazine.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-5,5-dimethyl-2-phenylpiperazine |
|---|---|
| PubChem CID | 64839742 |
| Molecular Formula | C17H21BrN2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-5,5-dimethyl-2-phenylpiperazine |
| SMILES | CC1(C)CN(Cc2sccc2Br)C(c2ccccc2)CN1 |
| InChI | InChI=1S/C17H21BrN2S/c1-17(2)12-20(11-16-14(18)8-9-21-16)15(10-19-17)13-6-4-3-5-7-13/h3-9,15,19H,10-12H2,1-2H3 |
| InChIKey | RZHZDQMCWDEKDR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |