C14H28N2 — CID 64839855
8-propan-2-yl-6-propyl-6,9-diazaspiro[4.5]decane (PubChem CID 64839855) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 8-propan-2-yl-6-propyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-propan-2-yl-6-propyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64839855 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 8-propan-2-yl-6-propyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCCN1CC(C(C)C)NCC12CCCC2 |
| InChI | InChI=1S/C14H28N2/c1-4-9-16-10-13(12(2)3)15-11-14(16)7-5-6-8-14/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | MIDGLDZTRRSZDR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |