About ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate
ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate (PubChem CID 6483989) has the molecular formula C17H19N3O4
and a molecular weight of 329.36 g/mol. Its IUPAC name is ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate |
| PubChem CID | 6483989 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CCC#N)nc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-4-24-17(21)13-11-20(9-5-8-18)19-16(13)12-6-7-14(22-2)15(10-12)23-3/h6-7,10-11H,4-5,9H2,1-3H3 |
| InChIKey | UZXVIPVTUJZCNO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate (CID 6483989) is ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate is CCOC(=O)c1cn(CCC#N)nc1-c1ccc(OC)c(OC)c1.
What is the InChIKey of ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate?
The InChIKey is UZXVIPVTUJZCNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O4/c1-4-24-17(21)13-11-20(9-5-8-18)19-16(13)12-6-7-14(22-2)15(10-12)23-3/h6-7,10-11H,4-5,9H2,1-3H3.
What are the key properties of ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate?
ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate has a molecular weight of 329.36 g/mol, XLogP of 2.66, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2-cyanoethyl)-3-(3,4-dimethoxyphenyl)pyrazole-4-carboxylate is sourced from PubChem (CID 6483989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).