About 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane
6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane (PubChem CID 64839988) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane |
| PubChem CID | 64839988 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane |
| SMILES | C=CCN1CC(CCC)NCC12CCCC2 |
| InChI | InChI=1S/C14H26N2/c1-3-7-13-11-16(10-4-2)14(12-15-13)8-5-6-9-14/h4,13,15H,2-3,5-12H2,1H3 |
| InChIKey | LLKKUAPSGOLMPN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane?
The IUPAC name of 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane (CID 64839988) is 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane is C=CCN1CC(CCC)NCC12CCCC2.
What is the InChIKey of 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane?
The InChIKey is LLKKUAPSGOLMPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2/c1-3-7-13-11-16(10-4-2)14(12-15-13)8-5-6-9-14/h4,13,15H,2-3,5-12H2,1H3.
What are the key properties of 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane?
6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane has a molecular weight of 222.38 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-enyl-8-propyl-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 64839988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).