About 2-chloro-5,6-dimethylpyridine-3-carboxylic acid
2-chloro-5,6-dimethylpyridine-3-carboxylic acid (PubChem CID 6484125) has the molecular formula C8H8ClNO2
and a molecular weight of 185.61 g/mol. Its IUPAC name is 2-chloro-5,6-dimethylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-5,6-dimethylpyridine-3-carboxylic acid |
| PubChem CID | 6484125 |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.02 |
| IUPAC Name | 2-chloro-5,6-dimethylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(Cl)nc1C |
| InChI | InChI=1S/C8H8ClNO2/c1-4-3-6(8(11)12)7(9)10-5(4)2/h3H,1-2H3,(H,11,12) |
| InChIKey | JGTHNXDWSRAIAT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5,6-dimethylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 2-chloro-5,6-dimethylpyridine-3-carboxylic acid (CID 6484125) is 2-chloro-5,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 2-chloro-5,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 2-chloro-5,6-dimethylpyridine-3-carboxylic acid is Cc1cc(C(=O)O)c(Cl)nc1C.
What is the InChIKey of 2-chloro-5,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is JGTHNXDWSRAIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2/c1-4-3-6(8(11)12)7(9)10-5(4)2/h3H,1-2H3,(H,11,12).
What are the key properties of 2-chloro-5,6-dimethylpyridine-3-carboxylic acid?
2-chloro-5,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 185.61 g/mol, XLogP of 2.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 6484125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).