C15H22F2N2 — CID 64841386
1-[(2,5-difluorophenyl)methyl]-5-ethyl-2,2-dimethylpiperazine (PubChem CID 64841386) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-5-ethyl-2,2-dimethylpiperazine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-5-ethyl-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 64841386 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-5-ethyl-2,2-dimethylpiperazine |
| SMILES | CCC1CN(Cc2cc(F)ccc2F)C(C)(C)CN1 |
| InChI | InChI=1S/C15H22F2N2/c1-4-13-9-19(15(2,3)10-18-13)8-11-7-12(16)5-6-14(11)17/h5-7,13,18H,4,8-10H2,1-3H3 |
| InChIKey | AZUUQZBVAFNVDZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |