C14H25F3N2O — CID 64841406
8-ethyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane (PubChem CID 64841406) has the molecular formula C14H25F3N2O and a molecular weight of 294.36 g/mol. Its IUPAC name is 8-ethyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64841406 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 8-ethyl-6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1CN(CCOCC(F)(F)F)C2(CCCC2)CN1 |
| InChI | InChI=1S/C14H25F3N2O/c1-2-12-9-19(7-8-20-11-14(15,16)17)13(10-18-12)5-3-4-6-13/h12,18H,2-11H2,1H3 |
| InChIKey | XHNAXNIILPUAFQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|