About 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine
2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine (PubChem CID 64841495) has the molecular formula C17H29N3O
and a molecular weight of 291.44 g/mol. Its IUPAC name is 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine.
Molecular Properties
| Compound Name | 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine |
| PubChem CID | 64841495 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine |
| SMILES | CCC1(CC)CNC(C)(C)CN1Cc1cccc(OC)n1 |
| InChI | InChI=1S/C17H29N3O/c1-6-17(7-2)12-18-16(3,4)13-20(17)11-14-9-8-10-15(19-14)21-5/h8-10,18H,6-7,11-13H2,1-5H3 |
| InChIKey | AYOIOWRHOZSSPL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
The IUPAC name of 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine (CID 64841495) is 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine.
What is the SMILES notation for 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
The canonical SMILES for 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine is CCC1(CC)CNC(C)(C)CN1Cc1cccc(OC)n1.
What is the InChIKey of 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
The InChIKey is AYOIOWRHOZSSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O/c1-6-17(7-2)12-18-16(3,4)13-20(17)11-14-9-8-10-15(19-14)21-5/h8-10,18H,6-7,11-13H2,1-5H3.
What are the key properties of 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine?
2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine has a molecular weight of 291.44 g/mol, XLogP of 2.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-1-[(6-methoxy-2-pyridinyl)methyl]-5,5-dimethylpiperazine is sourced from PubChem (CID 64841495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).