About 3-cyclohexyl-1,2-oxazole-5-carboxylic acid
3-cyclohexyl-1,2-oxazole-5-carboxylic acid (PubChem CID 6484168) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-cyclohexyl-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-cyclohexyl-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 6484168 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-cyclohexyl-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CCCCC2)no1 |
| InChI | InChI=1S/C10H13NO3/c12-10(13)9-6-8(11-14-9)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,12,13) |
| InChIKey | NWLZQPLTGHCFHG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-cyclohexyl-1,2-oxazole-5-carboxylic acid (CID 6484168) is 3-cyclohexyl-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-cyclohexyl-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-cyclohexyl-1,2-oxazole-5-carboxylic acid is O=C(O)c1cc(C2CCCCC2)no1.
What is the InChIKey of 3-cyclohexyl-1,2-oxazole-5-carboxylic acid?
The InChIKey is NWLZQPLTGHCFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c12-10(13)9-6-8(11-14-9)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,12,13).
What are the key properties of 3-cyclohexyl-1,2-oxazole-5-carboxylic acid?
3-cyclohexyl-1,2-oxazole-5-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 6484168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).