C16H24F2N2 — CID 64841727
1-[(2,3-difluorophenyl)methyl]-5-ethyl-2-propylpiperazine (PubChem CID 64841727) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[(2,3-difluorophenyl)methyl]-5-ethyl-2-propylpiperazine.
| Compound Name | 1-[(2,3-difluorophenyl)methyl]-5-ethyl-2-propylpiperazine |
|---|---|
| PubChem CID | 64841727 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[(2,3-difluorophenyl)methyl]-5-ethyl-2-propylpiperazine |
| SMILES | CCCC1CNC(CC)CN1Cc1cccc(F)c1F |
| InChI | InChI=1S/C16H24F2N2/c1-3-6-14-9-19-13(4-2)11-20(14)10-12-7-5-8-15(17)16(12)18/h5,7-8,13-14,19H,3-4,6,9-11H2,1-2H3 |
| InChIKey | MCNNCRRJHSIOGI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |