About 3-(1H-1,2,4-triazol-5-yl)aniline
3-(1H-1,2,4-triazol-5-yl)aniline (PubChem CID 6484188) has the molecular formula C8H8N4
and a molecular weight of 160.18 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-yl)aniline.
Molecular Properties
| Compound Name | 3-(1H-1,2,4-triazol-5-yl)aniline |
| PubChem CID | 6484188 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-yl)aniline |
| SMILES | Nc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H8N4/c9-7-3-1-2-6(4-7)8-10-5-11-12-8/h1-5H,9H2,(H,10,11,12) |
| InChIKey | VSXMKTLGTASQST-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-1,2,4-triazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-1,2,4-triazol-5-yl)aniline?
The IUPAC name of 3-(1H-1,2,4-triazol-5-yl)aniline (CID 6484188) is 3-(1H-1,2,4-triazol-5-yl)aniline.
What is the SMILES notation for 3-(1H-1,2,4-triazol-5-yl)aniline?
The canonical SMILES for 3-(1H-1,2,4-triazol-5-yl)aniline is Nc1cccc(-c2ncn[nH]2)c1.
What is the InChIKey of 3-(1H-1,2,4-triazol-5-yl)aniline?
The InChIKey is VSXMKTLGTASQST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4/c9-7-3-1-2-6(4-7)8-10-5-11-12-8/h1-5H,9H2,(H,10,11,12).
What are the key properties of 3-(1H-1,2,4-triazol-5-yl)aniline?
3-(1H-1,2,4-triazol-5-yl)aniline has a molecular weight of 160.18 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-1,2,4-triazol-5-yl)aniline is sourced from PubChem (CID 6484188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).