About 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine
1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine (PubChem CID 64841983) has the molecular formula C17H26BrFN2
and a molecular weight of 357.31 g/mol. Its IUPAC name is 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine.
Molecular Properties
| Compound Name | 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine |
| PubChem CID | 64841983 |
| Molecular Formula | C17H26BrFN2 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine |
| SMILES | CCC1CN(Cc2ccc(F)c(Br)c2)C(CC)(CC)CN1 |
| InChI | InChI=1S/C17H26BrFN2/c1-4-14-11-21(17(5-2,6-3)12-20-14)10-13-7-8-16(19)15(18)9-13/h7-9,14,20H,4-6,10-12H2,1-3H3 |
| InChIKey | XUZCYBGFXJNISK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine?
The IUPAC name of 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine (CID 64841983) is 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine.
What is the SMILES notation for 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine?
The canonical SMILES for 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine is CCC1CN(Cc2ccc(F)c(Br)c2)C(CC)(CC)CN1.
What is the InChIKey of 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine?
The InChIKey is XUZCYBGFXJNISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26BrFN2/c1-4-14-11-21(17(5-2,6-3)12-20-14)10-13-7-8-16(19)15(18)9-13/h7-9,14,20H,4-6,10-12H2,1-3H3.
What are the key properties of 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine?
1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine has a molecular weight of 357.31 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-bromo-4-fluorophenyl)methyl]-2,2,5-triethylpiperazine is sourced from PubChem (CID 64841983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).