About 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine
4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine (PubChem CID 6484201) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine |
| PubChem CID | 6484201 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine |
| SMILES | CN1CCC(CN)(N(C)C)CC1 |
| InChI | InChI=1S/C9H21N3/c1-11(2)9(8-10)4-6-12(3)7-5-9/h4-8,10H2,1-3H3 |
| InChIKey | YLOZCKVJAIJJEJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine?
The IUPAC name of 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine (CID 6484201) is 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine.
What is the SMILES notation for 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine?
The canonical SMILES for 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine is CN1CCC(CN)(N(C)C)CC1.
What is the InChIKey of 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine?
The InChIKey is YLOZCKVJAIJJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-11(2)9(8-10)4-6-12(3)7-5-9/h4-8,10H2,1-3H3.
What are the key properties of 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine?
4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine has a molecular weight of 171.29 g/mol, XLogP of -0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-N,N,1-trimethylpiperidin-4-amine is sourced from PubChem (CID 6484201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).