About 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid
5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid (PubChem CID 6484242) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 6484242 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid |
| SMILES | Cc1onc(C(C)C)c1C(=O)O |
| InChI | InChI=1S/C8H11NO3/c1-4(2)7-6(8(10)11)5(3)12-9-7/h4H,1-3H3,(H,10,11) |
| InChIKey | TYGXTLZIBFXYQP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid (CID 6484242) is 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid is Cc1onc(C(C)C)c1C(=O)O.
What is the InChIKey of 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid?
The InChIKey is TYGXTLZIBFXYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-4(2)7-6(8(10)11)5(3)12-9-7/h4H,1-3H3,(H,10,11).
What are the key properties of 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid?
5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid has a molecular weight of 169.18 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-propan-2-yl-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 6484242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).