C15H29F3N2O — CID 64842451
5-tert-butyl-2,2-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine (PubChem CID 64842451) has the molecular formula C15H29F3N2O and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-tert-butyl-2,2-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine.
| Compound Name | 5-tert-butyl-2,2-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine |
|---|---|
| PubChem CID | 64842451 |
| Molecular Formula | C15H29F3N2O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 5-tert-butyl-2,2-dimethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine |
| SMILES | CC(C)(C)C1CN(CCCOCC(F)(F)F)C(C)(C)CN1 |
| InChI | InChI=1S/C15H29F3N2O/c1-13(2,3)12-9-20(14(4,5)10-19-12)7-6-8-21-11-15(16,17)18/h12,19H,6-11H2,1-5H3 |
| InChIKey | XVXSDCIPHGSYQH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|