3-ethyl-1,2-oxazole-5-carboxylic acid

C6H7NO3 — CID 6484277

IUPAC3-ethyl-1,2-oxazole-5-carboxylic acid
SMILESCCc1cc(C(=O)O)on1
InChIInChI=1S/C6H7NO3/c1-2-4-3-5(6(8)9)10-7-4/h3H,2H2,1H3,(H,8,9)
InChIKeyWHBIWWYTGXQXSD-UHFFFAOYSA-N
MW141.13 g/mol
LogP0.94
Rot. Bonds2

About 3-ethyl-1,2-oxazole-5-carboxylic acid

3-ethyl-1,2-oxazole-5-carboxylic acid (PubChem CID 6484277) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 3-ethyl-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-ethyl-1,2-oxazole-5-carboxylic acid
PubChem CID6484277
Molecular FormulaC6H7NO3
Molecular Weight141.13 g/mol
Exact Mass141.04
IUPAC Name3-ethyl-1,2-oxazole-5-carboxylic acid
SMILESCCc1cc(C(=O)O)on1
InChIInChI=1S/C6H7NO3/c1-2-4-3-5(6(8)9)10-7-4/h3H,2H2,1H3,(H,8,9)
InChIKeyWHBIWWYTGXQXSD-UHFFFAOYSA-N
XLogP0.94
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-ethyl-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethyl-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-ethyl-1,2-oxazole-5-carboxylic acid (CID 6484277) is 3-ethyl-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-ethyl-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-ethyl-1,2-oxazole-5-carboxylic acid is CCc1cc(C(=O)O)on1.
What is the InChIKey of 3-ethyl-1,2-oxazole-5-carboxylic acid?
The InChIKey is WHBIWWYTGXQXSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c1-2-4-3-5(6(8)9)10-7-4/h3H,2H2,1H3,(H,8,9).
What are the key properties of 3-ethyl-1,2-oxazole-5-carboxylic acid?
3-ethyl-1,2-oxazole-5-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 6484277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).