C15H29F3N2 — CID 64842846
5-tert-butyl-2,2-diethyl-1-(3,3,3-trifluoropropyl)piperazine (PubChem CID 64842846) has the molecular formula C15H29F3N2 and a molecular weight of 294.41 g/mol. Its IUPAC name is 5-tert-butyl-2,2-diethyl-1-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | 5-tert-butyl-2,2-diethyl-1-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 64842846 |
| Molecular Formula | C15H29F3N2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 5-tert-butyl-2,2-diethyl-1-(3,3,3-trifluoropropyl)piperazine |
| SMILES | CCC1(CC)CNC(C(C)(C)C)CN1CCC(F)(F)F |
| InChI | InChI=1S/C15H29F3N2/c1-6-14(7-2)11-19-12(13(3,4)5)10-20(14)9-8-15(16,17)18/h12,19H,6-11H2,1-5H3 |
| InChIKey | WMPIFHDXUSBXFC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |