C16H32N2O2 — CID 64842964
3-ethyl-1-[2-(2-methoxyethoxy)ethyl]-1,4-diazaspiro[5.5]undecane (PubChem CID 64842964) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 3-ethyl-1-[2-(2-methoxyethoxy)ethyl]-1,4-diazaspiro[5.5]undecane.
| Compound Name | 3-ethyl-1-[2-(2-methoxyethoxy)ethyl]-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 64842964 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 3-ethyl-1-[2-(2-methoxyethoxy)ethyl]-1,4-diazaspiro[5.5]undecane |
| SMILES | CCC1CN(CCOCCOC)C2(CCCCC2)CN1 |
| InChI | InChI=1S/C16H32N2O2/c1-3-15-13-18(9-10-20-12-11-19-2)16(14-17-15)7-5-4-6-8-16/h15,17H,3-14H2,1-2H3 |
| InChIKey | OEXJXVUTYACTIX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|