C14H27F3N2 — CID 64843214
5-tert-butyl-2,2-diethyl-1-(2,2,2-trifluoroethyl)piperazine (PubChem CID 64843214) has the molecular formula C14H27F3N2 and a molecular weight of 280.38 g/mol. Its IUPAC name is 5-tert-butyl-2,2-diethyl-1-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 5-tert-butyl-2,2-diethyl-1-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 64843214 |
| Molecular Formula | C14H27F3N2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 5-tert-butyl-2,2-diethyl-1-(2,2,2-trifluoroethyl)piperazine |
| SMILES | CCC1(CC)CNC(C(C)(C)C)CN1CC(F)(F)F |
| InChI | InChI=1S/C14H27F3N2/c1-6-13(7-2)9-18-11(12(3,4)5)8-19(13)10-14(15,16)17/h11,18H,6-10H2,1-5H3 |
| InChIKey | LBSGTNKYUOOQSO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |