C13H28N2O2S — CID 64843827
2,2-diethyl-5,5-dimethyl-1-(2-methylsulfonylethyl)piperazine (PubChem CID 64843827) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 2,2-diethyl-5,5-dimethyl-1-(2-methylsulfonylethyl)piperazine.
| Compound Name | 2,2-diethyl-5,5-dimethyl-1-(2-methylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 64843827 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2,2-diethyl-5,5-dimethyl-1-(2-methylsulfonylethyl)piperazine |
| SMILES | CCC1(CC)CNC(C)(C)CN1CCS(C)(=O)=O |
| InChI | InChI=1S/C13H28N2O2S/c1-6-13(7-2)10-14-12(3,4)11-15(13)8-9-18(5,16)17/h14H,6-11H2,1-5H3 |
| InChIKey | ICCRZQRRGNYBIE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |