C14H28N2 — CID 64843856
1-(cyclopentylmethyl)-2,5-diethylpiperazine (PubChem CID 64843856) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-2,5-diethylpiperazine.
| Compound Name | 1-(cyclopentylmethyl)-2,5-diethylpiperazine |
|---|---|
| PubChem CID | 64843856 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-(cyclopentylmethyl)-2,5-diethylpiperazine |
| SMILES | CCC1CN(CC2CCCC2)C(CC)CN1 |
| InChI | InChI=1S/C14H28N2/c1-3-13-11-16(14(4-2)9-15-13)10-12-7-5-6-8-12/h12-15H,3-11H2,1-2H3 |
| InChIKey | DKMXYXYLBLLUBL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |