C18H20N2O4 — CID 6484406
prop-2-enyl 6-hydroxy-6-methyl-3-oxo-4-phenyl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 6484406) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is prop-2-enyl 6-hydroxy-6-methyl-3-oxo-4-phenyl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | prop-2-enyl 6-hydroxy-6-methyl-3-oxo-4-phenyl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 6484406 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | prop-2-enyl 6-hydroxy-6-methyl-3-oxo-4-phenyl-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | C=CCOC(=O)C1C(c2ccccc2)c2c([nH][nH]c2=O)CC1(C)O |
| InChI | InChI=1S/C18H20N2O4/c1-3-9-24-17(22)15-13(11-7-5-4-6-8-11)14-12(10-18(15,2)23)19-20-16(14)21/h3-8,13,15,23H,1,9-10H2,2H3,(H2,19,20,21) |
| InChIKey | QJMKIQFMTIQJHR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|