C18H19FN2O4 — CID 6484408
prop-2-enyl 4-(4-fluorophenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 6484408) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is prop-2-enyl 4-(4-fluorophenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | prop-2-enyl 4-(4-fluorophenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 6484408 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | prop-2-enyl 4-(4-fluorophenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | C=CCOC(=O)C1C(c2ccc(F)cc2)c2c([nH][nH]c2=O)CC1(C)O |
| InChI | InChI=1S/C18H19FN2O4/c1-3-8-25-17(23)15-13(10-4-6-11(19)7-5-10)14-12(9-18(15,2)24)20-21-16(14)22/h3-7,13,15,24H,1,8-9H2,2H3,(H2,20,21,22) |
| InChIKey | KKHJGBIRUSYQPY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|