C19H18N2O3 — CID 648450
N-pyridin-2-yl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide (PubChem CID 648450) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-pyridin-2-yl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide.
| Compound Name | N-pyridin-2-yl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
|---|---|
| PubChem CID | 648450 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-pyridin-2-yl-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
| SMILES | O=C(COc1ccc2oc3c(c2c1)CCCC3)Nc1ccccn1 |
| InChI | InChI=1S/C19H18N2O3/c22-19(21-18-7-3-4-10-20-18)12-23-13-8-9-17-15(11-13)14-5-1-2-6-16(14)24-17/h3-4,7-11H,1-2,5-6,12H2,(H,20,21,22) |
| InChIKey | BROSZMJOGNUDAM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |