C12H21F3N2O — CID 64845807
6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane (PubChem CID 64845807) has the molecular formula C12H21F3N2O and a molecular weight of 266.31 g/mol. Its IUPAC name is 6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane.
| Compound Name | 6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64845807 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 6-[2-(2,2,2-trifluoroethoxy)ethyl]-6,9-diazaspiro[4.5]decane |
| SMILES | FC(F)(F)COCCN1CCNCC12CCCC2 |
| InChI | InChI=1S/C12H21F3N2O/c13-12(14,15)10-18-8-7-17-6-5-16-9-11(17)3-1-2-4-11/h16H,1-10H2 |
| InChIKey | WTKGLLDLWRKCEQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|