C19H27FN4O2 — CID 648467
1-(3-fluorophenyl)-3-[1-(4-methylpiperazine-1-carbonyl)cyclohexyl]urea (PubChem CID 648467) has the molecular formula C19H27FN4O2 and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[1-(4-methylpiperazine-1-carbonyl)cyclohexyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[1-(4-methylpiperazine-1-carbonyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 648467 |
| Molecular Formula | C19H27FN4O2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[1-(4-methylpiperazine-1-carbonyl)cyclohexyl]urea |
| SMILES | CN1CCN(C(=O)C2(NC(=O)Nc3cccc(F)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C19H27FN4O2/c1-23-10-12-24(13-11-23)17(25)19(8-3-2-4-9-19)22-18(26)21-16-7-5-6-15(20)14-16/h5-7,14H,2-4,8-13H2,1H3,(H2,21,22,26) |
| InChIKey | ITDYIZHUKNXDFG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |