About (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine
(4,5-dimethyl-1,3-thiazol-2-yl)hydrazine (PubChem CID 6484681) has the molecular formula C5H9N3S
and a molecular weight of 143.21 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine.
Molecular Properties
| Compound Name | (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine |
| PubChem CID | 6484681 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine |
| SMILES | Cc1nc(NN)sc1C |
| InChI | InChI=1S/C5H9N3S/c1-3-4(2)9-5(7-3)8-6/h6H2,1-2H3,(H,7,8) |
| InChIKey | VXFWYILDQLZFDA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine?
The IUPAC name of (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine (CID 6484681) is (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine.
What is the SMILES notation for (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine?
The canonical SMILES for (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine is Cc1nc(NN)sc1C.
What is the InChIKey of (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine?
The InChIKey is VXFWYILDQLZFDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S/c1-3-4(2)9-5(7-3)8-6/h6H2,1-2H3,(H,7,8).
What are the key properties of (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine?
(4,5-dimethyl-1,3-thiazol-2-yl)hydrazine has a molecular weight of 143.21 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethyl-1,3-thiazol-2-yl)hydrazine is sourced from PubChem (CID 6484681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).