About 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde
5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde (PubChem CID 6484683) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde.
Molecular Properties
| Compound Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde |
| PubChem CID | 6484683 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde |
| SMILES | Cc1cc(C)n2ncc(C=O)c2n1 |
| InChI | InChI=1S/C9H9N3O/c1-6-3-7(2)12-9(11-6)8(5-13)4-10-12/h3-5H,1-2H3 |
| InChIKey | MYZRYTYZNHXGQA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde?
The IUPAC name of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde (CID 6484683) is 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde.
What is the SMILES notation for 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde?
The canonical SMILES for 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde is Cc1cc(C)n2ncc(C=O)c2n1.
What is the InChIKey of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde?
The InChIKey is MYZRYTYZNHXGQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-6-3-7(2)12-9(11-6)8(5-13)4-10-12/h3-5H,1-2H3.
What are the key properties of 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde?
5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde has a molecular weight of 175.19 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbaldehyde is sourced from PubChem (CID 6484683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).