About 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine
1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine (PubChem CID 64846932) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine.
Molecular Properties
| Compound Name | 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine |
| PubChem CID | 64846932 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine |
| SMILES | COCCCN1CC(C)NCC1(C)c1ccccc1 |
| InChI | InChI=1S/C16H26N2O/c1-14-12-18(10-7-11-19-3)16(2,13-17-14)15-8-5-4-6-9-15/h4-6,8-9,14,17H,7,10-13H2,1-3H3 |
| InChIKey | JXEZAEBWLSZWQH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine?
The IUPAC name of 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine (CID 64846932) is 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine.
What is the SMILES notation for 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine?
The canonical SMILES for 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine is COCCCN1CC(C)NCC1(C)c1ccccc1.
What is the InChIKey of 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine?
The InChIKey is JXEZAEBWLSZWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O/c1-14-12-18(10-7-11-19-3)16(2,13-17-14)15-8-5-4-6-9-15/h4-6,8-9,14,17H,7,10-13H2,1-3H3.
What are the key properties of 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine?
1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine has a molecular weight of 262.40 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxypropyl)-2,5-dimethyl-2-phenylpiperazine is sourced from PubChem (CID 64846932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).