C16H34N2 — CID 64847195
2-butan-2-yl-1,5-bis(2-methylpropyl)piperazine (PubChem CID 64847195) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 2-butan-2-yl-1,5-bis(2-methylpropyl)piperazine.
| Compound Name | 2-butan-2-yl-1,5-bis(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 64847195 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 2-butan-2-yl-1,5-bis(2-methylpropyl)piperazine |
| SMILES | CCC(C)C1CNC(CC(C)C)CN1CC(C)C |
| InChI | InChI=1S/C16H34N2/c1-7-14(6)16-9-17-15(8-12(2)3)11-18(16)10-13(4)5/h12-17H,7-11H2,1-6H3 |
| InChIKey | SKYLUQNYJGJBJQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |