About 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine
5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine (PubChem CID 64849852) has the molecular formula C13H28N2O2S
and a molecular weight of 276.45 g/mol. Its IUPAC name is 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine.
Molecular Properties
| Compound Name | 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine |
| PubChem CID | 64849852 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine |
| SMILES | CCC1(C)CN(CCCS(C)(=O)=O)C(C)(C)CN1 |
| InChI | InChI=1S/C13H28N2O2S/c1-6-13(4)11-15(12(2,3)10-14-13)8-7-9-18(5,16)17/h14H,6-11H2,1-5H3 |
| InChIKey | RLRISYXKKIPVTP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine?
The IUPAC name of 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine (CID 64849852) is 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine.
What is the SMILES notation for 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine?
The canonical SMILES for 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine is CCC1(C)CN(CCCS(C)(=O)=O)C(C)(C)CN1.
What is the InChIKey of 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine?
The InChIKey is RLRISYXKKIPVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2S/c1-6-13(4)11-15(12(2,3)10-14-13)8-7-9-18(5,16)17/h14H,6-11H2,1-5H3.
What are the key properties of 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine?
5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine has a molecular weight of 276.45 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,2,5-trimethyl-1-(3-methylsulfonylpropyl)piperazine is sourced from PubChem (CID 64849852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).