C17H30N4 — CID 64849982
2-[(5-butan-2-yl-2-tert-butylpiperazin-1-yl)methyl]pyrimidine (PubChem CID 64849982) has the molecular formula C17H30N4 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-[(5-butan-2-yl-2-tert-butylpiperazin-1-yl)methyl]pyrimidine.
| Compound Name | 2-[(5-butan-2-yl-2-tert-butylpiperazin-1-yl)methyl]pyrimidine |
|---|---|
| PubChem CID | 64849982 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2-[(5-butan-2-yl-2-tert-butylpiperazin-1-yl)methyl]pyrimidine |
| SMILES | CCC(C)C1CN(Cc2ncccn2)C(C(C)(C)C)CN1 |
| InChI | InChI=1S/C17H30N4/c1-6-13(2)14-11-21(12-16-18-8-7-9-19-16)15(10-20-14)17(3,4)5/h7-9,13-15,20H,6,10-12H2,1-5H3 |
| InChIKey | HNDPRANVRSYSEV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |