C17H26Cl2N2 — CID 64850045
1-[(2,6-dichlorophenyl)methyl]-2,5-diethyl-2,5-dimethylpiperazine (PubChem CID 64850045) has the molecular formula C17H26Cl2N2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-2,5-diethyl-2,5-dimethylpiperazine.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-2,5-diethyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64850045 |
| Molecular Formula | C17H26Cl2N2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-2,5-diethyl-2,5-dimethylpiperazine |
| SMILES | CCC1(C)CN(Cc2c(Cl)cccc2Cl)C(C)(CC)CN1 |
| InChI | InChI=1S/C17H26Cl2N2/c1-5-16(3)12-21(17(4,6-2)11-20-16)10-13-14(18)8-7-9-15(13)19/h7-9,20H,5-6,10-12H2,1-4H3 |
| InChIKey | CVYOTAKORLXYEX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |